C46H56N4O7S3 — CID 139658148
4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione (PubChem CID 139658148) has the molecular formula C46H56N4O7S3 and a molecular weight of 873.18 g/mol. Its IUPAC name is 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139658148 |
| Molecular Formula | C46H56N4O7S3 |
| Molecular Weight | 873.18 g/mol |
| Exact Mass | 872.33 |
| IUPAC Name | 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
| SMILES | COc1cc(CN2CCN(Cc3cc(-c4ssc(=S)c4Cc4ccccc4)cc(CN4CCN(Cc5cc(OC)cc(OC)c5OC)CC4)c3O)CC2)c(OC)c(OC)c1 |
| InChI | InChI=1S/C46H56N4O7S3/c1-52-37-23-35(43(56-5)40(25-37)54-3)29-49-16-12-47(13-17-49)27-33-21-32(45-39(46(58)60-59-45)20-31-10-8-7-9-11-31)22-34(42(33)51)28-48-14-18-50(19-15-48)30-36-24-38(53-2)26-41(55-4)44(36)57-6/h7-11,21-26,51H,12-20,27-30H2,1-6H3 |
| InChIKey | ROURPNJCNUEULF-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.18 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|