C29H42N4O3S3 — CID 139657781
1-[4-[[3-[(4-butanoylpiperazin-1-yl)methyl]-5-(4-ethyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]butan-1-one (PubChem CID 139657781) has the molecular formula C29H42N4O3S3 and a molecular weight of 590.88 g/mol. Its IUPAC name is 1-[4-[[3-[(4-butanoylpiperazin-1-yl)methyl]-5-(4-ethyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[[3-[(4-butanoylpiperazin-1-yl)methyl]-5-(4-ethyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 139657781 |
| Molecular Formula | C29H42N4O3S3 |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 1-[4-[[3-[(4-butanoylpiperazin-1-yl)methyl]-5-(4-ethyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(Cc2cc(-c3ssc(=S)c3CC)cc(CN3CCN(C(=O)CCC)CC3)c2O)CC1 |
| InChI | InChI=1S/C29H42N4O3S3/c1-4-7-25(34)32-13-9-30(10-14-32)19-22-17-21(28-24(6-3)29(37)39-38-28)18-23(27(22)36)20-31-11-15-33(16-12-31)26(35)8-5-2/h17-18,36H,4-16,19-20H2,1-3H3 |
| InChIKey | KQPIZOWCYCMYNO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|