C21H28N2O2S3 — CID 139657936
1-[4-[[5-(4-butyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]propan-1-one (PubChem CID 139657936) has the molecular formula C21H28N2O2S3 and a molecular weight of 436.67 g/mol. Its IUPAC name is 1-[4-[[5-(4-butyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[[5-(4-butyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 139657936 |
| Molecular Formula | C21H28N2O2S3 |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-[4-[[5-(4-butyl-5-sulfanylidenedithiol-3-yl)-2-hydroxyphenyl]methyl]piperazin-1-yl]propan-1-one |
| SMILES | CCCCc1c(-c2ccc(O)c(CN3CCN(C(=O)CC)CC3)c2)ssc1=S |
| InChI | InChI=1S/C21H28N2O2S3/c1-3-5-6-17-20(27-28-21(17)26)15-7-8-18(24)16(13-15)14-22-9-11-23(12-10-22)19(25)4-2/h7-8,13,24H,3-6,9-12,14H2,1-2H3 |
| InChIKey | FUFYLUAITHGNEN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|