C18H24N2OS3 — CID 139657983
4-ethyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione (PubChem CID 139657983) has the molecular formula C18H24N2OS3 and a molecular weight of 380.60 g/mol. Its IUPAC name is 4-ethyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-ethyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657983 |
| Molecular Formula | C18H24N2OS3 |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-ethyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione |
| SMILES | CCc1c(-c2ccc(O)c(CN3CCCN(C)CC3)c2)ssc1=S |
| InChI | InChI=1S/C18H24N2OS3/c1-3-15-17(23-24-18(15)22)13-5-6-16(21)14(11-13)12-20-8-4-7-19(2)9-10-20/h5-6,11,21H,3-4,7-10,12H2,1-2H3 |
| InChIKey | BHAAOXALOZMECF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|