C29H46N4O3S3 — CID 139657982
4-ethyl-5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione (PubChem CID 139657982) has the molecular formula C29H46N4O3S3 and a molecular weight of 594.91 g/mol. Its IUPAC name is 4-ethyl-5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-ethyl-5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657982 |
| Molecular Formula | C29H46N4O3S3 |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 4-ethyl-5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
| SMILES | CCc1c(-c2cc(CN3CCN(CCCCO)CC3)c(O)c(CN3CCN(CCCCO)CC3)c2)ssc1=S |
| InChI | InChI=1S/C29H46N4O3S3/c1-2-26-28(38-39-29(26)37)23-19-24(21-32-13-9-30(10-14-32)7-3-5-17-34)27(36)25(20-23)22-33-15-11-31(12-16-33)8-4-6-18-35/h19-20,34-36H,2-18,21-22H2,1H3 |
| InChIKey | UGYOFPMLEWGRSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|