C28H44N4O3S3 — CID 139658287
5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione (PubChem CID 139658287) has the molecular formula C28H44N4O3S3 and a molecular weight of 580.89 g/mol. Its IUPAC name is 5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
|---|---|
| PubChem CID | 139658287 |
| Molecular Formula | C28H44N4O3S3 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 5-[4-hydroxy-3,5-bis[[4-(4-hydroxybutyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
| SMILES | Cc1c(-c2cc(CN3CCN(CCCCO)CC3)c(O)c(CN3CCN(CCCCO)CC3)c2)ssc1=S |
| InChI | InChI=1S/C28H44N4O3S3/c1-22-27(37-38-28(22)36)23-18-24(20-31-12-8-29(9-13-31)6-2-4-16-33)26(35)25(19-23)21-32-14-10-30(11-15-32)7-3-5-17-34/h18-19,33-35H,2-17,20-21H2,1H3 |
| InChIKey | YKCJSZKEJDKIHO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|