C27H42N4OS3 — CID 139658284
5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]dithiole-3-thione (PubChem CID 139658284) has the molecular formula C27H42N4OS3 and a molecular weight of 534.86 g/mol. Its IUPAC name is 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]dithiole-3-thione.
| Compound Name | 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139658284 |
| Molecular Formula | C27H42N4OS3 |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]dithiole-3-thione |
| SMILES | CCCCN1CCN(Cc2cc(-c3cc(=S)ss3)cc(CN3CCN(CCCC)CC3)c2O)CC1 |
| InChI | InChI=1S/C27H42N4OS3/c1-3-5-7-28-9-13-30(14-10-28)20-23-17-22(25-19-26(33)35-34-25)18-24(27(23)32)21-31-15-11-29(12-16-31)8-6-4-2/h17-19,32H,3-16,20-21H2,1-2H3 |
| InChIKey | VMYAGOLRWBDKDX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|