C26H31N3O2S3 — CID 139657976
5-[3-[(4-benzylpiperazin-1-yl)methyl]-4-hydroxy-5-(morpholin-4-ylmethyl)phenyl]dithiole-3-thione (PubChem CID 139657976) has the molecular formula C26H31N3O2S3 and a molecular weight of 513.75 g/mol. Its IUPAC name is 5-[3-[(4-benzylpiperazin-1-yl)methyl]-4-hydroxy-5-(morpholin-4-ylmethyl)phenyl]dithiole-3-thione.
| Compound Name | 5-[3-[(4-benzylpiperazin-1-yl)methyl]-4-hydroxy-5-(morpholin-4-ylmethyl)phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657976 |
| Molecular Formula | C26H31N3O2S3 |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 5-[3-[(4-benzylpiperazin-1-yl)methyl]-4-hydroxy-5-(morpholin-4-ylmethyl)phenyl]dithiole-3-thione |
| SMILES | Oc1c(CN2CCOCC2)cc(-c2cc(=S)ss2)cc1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O2S3/c30-26-22(18-28-8-6-27(7-9-28)17-20-4-2-1-3-5-20)14-21(24-16-25(32)34-33-24)15-23(26)19-29-10-12-31-13-11-29/h1-5,14-16,30H,6-13,17-19H2 |
| InChIKey | OJTLGJYHVGWDPL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|