C19H31BrN2O4 — CID 177071319
7-benzyl-16-bromo-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane (PubChem CID 177071319) has the molecular formula C19H31BrN2O4 and a molecular weight of 431.37 g/mol. Its IUPAC name is 7-benzyl-16-bromo-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane.
| Compound Name | 7-benzyl-16-bromo-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
|---|---|
| PubChem CID | 177071319 |
| Molecular Formula | C19H31BrN2O4 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 7-benzyl-16-bromo-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
| SMILES | BrN1CCOCCOCCN(Cc2ccccc2)CCOCCOCC1 |
| InChI | InChI=1S/C19H31BrN2O4/c20-22-8-12-25-16-14-23-10-6-21(18-19-4-2-1-3-5-19)7-11-24-15-17-26-13-9-22/h1-5H,6-18H2 |
| InChIKey | HRUPTXRRVMLILZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|