C24H34N2O3 — CID 66663131
(4-benzylmorpholin-2-yl)methanol;4-benzyl-1,4-oxazepane (PubChem CID 66663131) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (4-benzylmorpholin-2-yl)methanol;4-benzyl-1,4-oxazepane.
| Compound Name | (4-benzylmorpholin-2-yl)methanol;4-benzyl-1,4-oxazepane |
|---|---|
| PubChem CID | 66663131 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (4-benzylmorpholin-2-yl)methanol;4-benzyl-1,4-oxazepane |
| SMILES | OCC1CN(Cc2ccccc2)CCO1.c1ccc(CN2CCCOCC2)cc1 |
| InChI | InChI=1S/C12H17NO2.C12H17NO/c14-10-12-9-13(6-7-15-12)8-11-4-2-1-3-5-11;1-2-5-12(6-3-1)11-13-7-4-9-14-10-8-13/h1-5,12,14H,6-10H2;1-3,5-6H,4,7-11H2 |
| InChIKey | FDCKGSNIXBGVJJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |