C18H26N2O4 — CID 99944117
3-[[(2R)-2-(morpholin-4-ylmethyl)-1,4-oxazepan-4-yl]methyl]benzoic acid (PubChem CID 99944117) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[[(2R)-2-(morpholin-4-ylmethyl)-1,4-oxazepan-4-yl]methyl]benzoic acid.
| Compound Name | 3-[[(2R)-2-(morpholin-4-ylmethyl)-1,4-oxazepan-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 99944117 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-[[(2R)-2-(morpholin-4-ylmethyl)-1,4-oxazepan-4-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCCO[C@@H](CN3CCOCC3)C2)c1 |
| InChI | InChI=1S/C18H26N2O4/c21-18(22)16-4-1-3-15(11-16)12-20-5-2-8-24-17(14-20)13-19-6-9-23-10-7-19/h1,3-4,11,17H,2,5-10,12-14H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | MNYBSPWKOALXQG-KRWDZBQOSA-N |
| XLogP | 1.31 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |