3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid

C17H23NO3 — CID 122034694

IUPAC3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid
SMILESO=C(O)c1cccc(CN2CCOCC(C3CCC3)C2)c1
InChIInChI=1S/C17H23NO3/c19-17(20)15-6-1-3-13(9-15)10-18-7-8-21-12-16(11-18)14-4-2-5-14/h1,3,6,9,14,16H,2,4-5,7-8,10-12H2,(H,19,20)
InChIKeyZUPNOJILIPOWJU-UHFFFAOYSA-N
MW289.37 g/mol
LogP2.63
Rot. Bonds4

About 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid

3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid (PubChem CID 122034694) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid.

Molecular Properties

Compound Name3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid
PubChem CID122034694
Molecular FormulaC17H23NO3
Molecular Weight289.37 g/mol
Exact Mass289.17
IUPAC Name3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid
SMILESO=C(O)c1cccc(CN2CCOCC(C3CCC3)C2)c1
InChIInChI=1S/C17H23NO3/c19-17(20)15-6-1-3-13(9-15)10-18-7-8-21-12-16(11-18)14-4-2-5-14/h1,3,6,9,14,16H,2,4-5,7-8,10-12H2,(H,19,20)
InChIKeyZUPNOJILIPOWJU-UHFFFAOYSA-N
XLogP2.63
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.37
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid?
The IUPAC name of 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid (CID 122034694) is 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid.
What is the SMILES notation for 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid?
The canonical SMILES for 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid is O=C(O)c1cccc(CN2CCOCC(C3CCC3)C2)c1.
What is the InChIKey of 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid?
The InChIKey is ZUPNOJILIPOWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c19-17(20)15-6-1-3-13(9-15)10-18-7-8-21-12-16(11-18)14-4-2-5-14/h1,3,6,9,14,16H,2,4-5,7-8,10-12H2,(H,19,20).
What are the key properties of 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid?
3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid has a molecular weight of 289.37 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid is sourced from PubChem (CID 122034694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).