C17H23NO3 — CID 122034694
3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid (PubChem CID 122034694) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid.
| Compound Name | 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 122034694 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[(6-cyclobutyl-1,4-oxazepan-4-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCOCC(C3CCC3)C2)c1 |
| InChI | InChI=1S/C17H23NO3/c19-17(20)15-6-1-3-13(9-15)10-18-7-8-21-12-16(11-18)14-4-2-5-14/h1,3,6,9,14,16H,2,4-5,7-8,10-12H2,(H,19,20) |
| InChIKey | ZUPNOJILIPOWJU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |