C18H18ClNO3 — CID 122034855
3-[[(2S)-2-(4-chlorophenyl)morpholin-4-yl]methyl]benzoic acid (PubChem CID 122034855) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-[[(2S)-2-(4-chlorophenyl)morpholin-4-yl]methyl]benzoic acid.
| Compound Name | 3-[[(2S)-2-(4-chlorophenyl)morpholin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122034855 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[[(2S)-2-(4-chlorophenyl)morpholin-4-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCO[C@@H](c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C18H18ClNO3/c19-16-6-4-14(5-7-16)17-12-20(8-9-23-17)11-13-2-1-3-15(10-13)18(21)22/h1-7,10,17H,8-9,11-12H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | GNDZIYQITRPACO-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |