C17H16ClNO5S — CID 110416888
3-[2-(4-chlorophenyl)morpholin-4-yl]sulfonylbenzoic acid (PubChem CID 110416888) has the molecular formula C17H16ClNO5S and a molecular weight of 381.84 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)morpholin-4-yl]sulfonylbenzoic acid.
| Compound Name | 3-[2-(4-chlorophenyl)morpholin-4-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 110416888 |
| Molecular Formula | C17H16ClNO5S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-[2-(4-chlorophenyl)morpholin-4-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCOC(c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C17H16ClNO5S/c18-14-6-4-12(5-7-14)16-11-19(8-9-24-16)25(22,23)15-3-1-2-13(10-15)17(20)21/h1-7,10,16H,8-9,11H2,(H,20,21) |
| InChIKey | MRYCNXJFKHFRHT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |