C18H17Cl2NO4S — CID 121134630
1-[4-[2-(3,5-dichlorophenyl)morpholin-4-yl]sulfonylphenyl]ethanone (PubChem CID 121134630) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is 1-[4-[2-(3,5-dichlorophenyl)morpholin-4-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[2-(3,5-dichlorophenyl)morpholin-4-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 121134630 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 1-[4-[2-(3,5-dichlorophenyl)morpholin-4-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCOC(c3cc(Cl)cc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C18H17Cl2NO4S/c1-12(22)13-2-4-17(5-3-13)26(23,24)21-6-7-25-18(11-21)14-8-15(19)10-16(20)9-14/h2-5,8-10,18H,6-7,11H2,1H3 |
| InChIKey | COEGFKSDDOPISI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |