C15H17Cl2N3O3S — CID 99827482
(2R)-4-(3,5-dichlorophenyl)sulfonyl-2-(1-ethylpyrazol-4-yl)morpholine (PubChem CID 99827482) has the molecular formula C15H17Cl2N3O3S and a molecular weight of 390.29 g/mol. Its IUPAC name is (2R)-4-(3,5-dichlorophenyl)sulfonyl-2-(1-ethylpyrazol-4-yl)morpholine.
| Compound Name | (2R)-4-(3,5-dichlorophenyl)sulfonyl-2-(1-ethylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 99827482 |
| Molecular Formula | C15H17Cl2N3O3S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | (2R)-4-(3,5-dichlorophenyl)sulfonyl-2-(1-ethylpyrazol-4-yl)morpholine |
| SMILES | CCn1cc([C@@H]2CN(S(=O)(=O)c3cc(Cl)cc(Cl)c3)CCO2)cn1 |
| InChI | InChI=1S/C15H17Cl2N3O3S/c1-2-19-9-11(8-18-19)15-10-20(3-4-23-15)24(21,22)14-6-12(16)5-13(17)7-14/h5-9,15H,2-4,10H2,1H3/t15-/m0/s1 |
| InChIKey | QFTGSUHOOFRPEQ-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |