C17H20N4O3S — CID 128999495
3-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]sulfonyl-4-methylbenzonitrile (PubChem CID 128999495) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]sulfonyl-4-methylbenzonitrile.
| Compound Name | 3-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]sulfonyl-4-methylbenzonitrile |
|---|---|
| PubChem CID | 128999495 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]sulfonyl-4-methylbenzonitrile |
| SMILES | CCn1cc(C2CN(S(=O)(=O)c3cc(C#N)ccc3C)CCO2)cn1 |
| InChI | InChI=1S/C17H20N4O3S/c1-3-20-11-15(10-19-20)16-12-21(6-7-24-16)25(22,23)17-8-14(9-18)5-4-13(17)2/h4-5,8,10-11,16H,3,6-7,12H2,1-2H3 |
| InChIKey | XPRGZJPNKNYFJY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |