C15H15ClN4O3S — CID 128998920
5-chloro-2-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]sulfonylbenzonitrile (PubChem CID 128998920) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 5-chloro-2-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]sulfonylbenzonitrile.
| Compound Name | 5-chloro-2-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 128998920 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-chloro-2-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]sulfonylbenzonitrile |
| SMILES | Cn1cc(C2CN(S(=O)(=O)c3ccc(Cl)cc3C#N)CCO2)cn1 |
| InChI | InChI=1S/C15H15ClN4O3S/c1-19-9-12(8-18-19)14-10-20(4-5-23-14)24(21,22)15-3-2-13(16)6-11(15)7-17/h2-3,6,8-9,14H,4-5,10H2,1H3 |
| InChIKey | ZYRYHZGUYQCGQC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |