C14H15ClFN3O3S — CID 75494719
4-(2-chloro-5-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 75494719) has the molecular formula C14H15ClFN3O3S and a molecular weight of 359.81 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)morpholine.
| Compound Name | 4-(2-chloro-5-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 75494719 |
| Molecular Formula | C14H15ClFN3O3S |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)sulfonyl-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cn1cc(C2CN(S(=O)(=O)c3cc(F)ccc3Cl)CCO2)cn1 |
| InChI | InChI=1S/C14H15ClFN3O3S/c1-18-8-10(7-17-18)13-9-19(4-5-22-13)23(20,21)14-6-11(16)2-3-12(14)15/h2-3,6-8,13H,4-5,9H2,1H3 |
| InChIKey | YMCFRPZPSPMSIR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |