C17H16Cl2FNO3S — CID 56581847
4-[(3,4-dichlorophenyl)methylsulfonyl]-2-(4-fluorophenyl)morpholine (PubChem CID 56581847) has the molecular formula C17H16Cl2FNO3S and a molecular weight of 404.29 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-(4-fluorophenyl)morpholine.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-(4-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 56581847 |
| Molecular Formula | C17H16Cl2FNO3S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfonyl]-2-(4-fluorophenyl)morpholine |
| SMILES | O=S(=O)(Cc1ccc(Cl)c(Cl)c1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H16Cl2FNO3S/c18-15-6-1-12(9-16(15)19)11-25(22,23)21-7-8-24-17(10-21)13-2-4-14(20)5-3-13/h1-6,9,17H,7-8,10-11H2 |
| InChIKey | GSLDQSKVPHCGFN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |