C12H17Cl3N2O2S — CID 119959718
1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-3-amine;hydrochloride (PubChem CID 119959718) has the molecular formula C12H17Cl3N2O2S and a molecular weight of 359.71 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119959718 |
| Molecular Formula | C12H17Cl3N2O2S |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H16Cl2N2O2S.ClH/c13-11-4-3-9(6-12(11)14)8-19(17,18)16-5-1-2-10(15)7-16;/h3-4,6,10H,1-2,5,7-8,15H2;1H |
| InChIKey | PGRGCJXIEXPNJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |