C13H18Cl2N2O4S2 — CID 56581987
1-[(3,4-dichlorophenyl)methylsulfonyl]-4-ethylsulfonylpiperazine (PubChem CID 56581987) has the molecular formula C13H18Cl2N2O4S2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-ethylsulfonylpiperazine.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-ethylsulfonylpiperazine |
|---|---|
| PubChem CID | 56581987 |
| Molecular Formula | C13H18Cl2N2O4S2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-4-ethylsulfonylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2N2O4S2/c1-2-22(18,19)16-5-7-17(8-6-16)23(20,21)10-11-3-4-12(14)13(15)9-11/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | QAQNCJJILABVII-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |