C13H18Cl2N2O2S — CID 119969410
[1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine (PubChem CID 119969410) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is [1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine.
| Compound Name | [1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 119969410 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [1-[(3,4-dichlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine |
| SMILES | NCC1CCCCN1S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c14-12-5-4-10(7-13(12)15)9-20(18,19)17-6-2-1-3-11(17)8-16/h4-5,7,11H,1-3,6,8-9,16H2 |
| InChIKey | MTHQWXWIBONAOH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |