C14H22N2O3S — CID 43579017
[1-[[4-(aminomethyl)phenyl]methylsulfonyl]piperidin-2-yl]methanol (PubChem CID 43579017) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is [1-[[4-(aminomethyl)phenyl]methylsulfonyl]piperidin-2-yl]methanol.
| Compound Name | [1-[[4-(aminomethyl)phenyl]methylsulfonyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 43579017 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [1-[[4-(aminomethyl)phenyl]methylsulfonyl]piperidin-2-yl]methanol |
| SMILES | NCc1ccc(CS(=O)(=O)N2CCCCC2CO)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c15-9-12-4-6-13(7-5-12)11-20(18,19)16-8-2-1-3-14(16)10-17/h4-7,14,17H,1-3,8-11,15H2 |
| InChIKey | RYGWFLSXDMKGBT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |