C16H24FN3O3S — CID 120584541
3-amino-N-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-2-yl]methyl]propanamide (PubChem CID 120584541) has the molecular formula C16H24FN3O3S and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-amino-N-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120584541 |
| Molecular Formula | C16H24FN3O3S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-amino-N-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1S(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FN3O3S/c17-14-6-4-13(5-7-14)12-24(22,23)20-10-2-1-3-15(20)11-19-16(21)8-9-18/h4-7,15H,1-3,8-12,18H2,(H,19,21) |
| InChIKey | IXBFSGWTPQCQNV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |