C16H31N3O3S — CID 120584411
3-amino-N-[[1-(cyclohexylmethylsulfonyl)piperidin-2-yl]methyl]propanamide (PubChem CID 120584411) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is 3-amino-N-[[1-(cyclohexylmethylsulfonyl)piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-(cyclohexylmethylsulfonyl)piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120584411 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-amino-N-[[1-(cyclohexylmethylsulfonyl)piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C16H31N3O3S/c17-10-9-16(20)18-12-15-8-4-5-11-19(15)23(21,22)13-14-6-2-1-3-7-14/h14-15H,1-13,17H2,(H,18,20) |
| InChIKey | BCPWIQYTNZPJFS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |