C13H20Cl2N2O2S — CID 119969227
[1-[(2-chlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine;hydrochloride (PubChem CID 119969227) has the molecular formula C13H20Cl2N2O2S and a molecular weight of 339.29 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-[(2-chlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119969227 |
| Molecular Formula | C13H20Cl2N2O2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [1-[(2-chlorophenyl)methylsulfonyl]piperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCN1S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H19ClN2O2S.ClH/c14-13-7-2-1-5-11(13)10-19(17,18)16-8-4-3-6-12(16)9-15;/h1-2,5,7,12H,3-4,6,8-10,15H2;1H |
| InChIKey | DNPWCUASDZBXKN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |