C12H16ClNO2S — CID 110749811
1-[(2-chlorophenyl)methylsulfonyl]-3-methylpyrrolidine (PubChem CID 110749811) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-3-methylpyrrolidine.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 110749811 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-methylpyrrolidine |
| SMILES | CC1CCN(S(=O)(=O)Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-10-6-7-14(8-10)17(15,16)9-11-4-2-3-5-12(11)13/h2-5,10H,6-9H2,1H3 |
| InChIKey | FUTSIRRUXIPDBZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |