C19H22Cl2N2O4S2 — CID 41301352
(2S)-1,4-bis[(2-chlorophenyl)methylsulfonyl]-2-methylpiperazine (PubChem CID 41301352) has the molecular formula C19H22Cl2N2O4S2 and a molecular weight of 477.44 g/mol. Its IUPAC name is (2S)-1,4-bis[(2-chlorophenyl)methylsulfonyl]-2-methylpiperazine.
| Compound Name | (2S)-1,4-bis[(2-chlorophenyl)methylsulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 41301352 |
| Molecular Formula | C19H22Cl2N2O4S2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | (2S)-1,4-bis[(2-chlorophenyl)methylsulfonyl]-2-methylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)Cc2ccccc2Cl)CCN1S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O4S2/c1-15-12-22(28(24,25)13-16-6-2-4-8-18(16)20)10-11-23(15)29(26,27)14-17-7-3-5-9-19(17)21/h2-9,15H,10-14H2,1H3/t15-/m0/s1 |
| InChIKey | XNKDXGUNLOCXEA-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |