C12H16ClNO4S2 — CID 72717812
1-[(2-chlorophenyl)methylsulfonyl]-3-methylsulfonylpyrrolidine (PubChem CID 72717812) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-3-methylsulfonylpyrrolidine.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 72717812 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)C1CCN(S(=O)(=O)Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-19(15,16)11-6-7-14(8-11)20(17,18)9-10-4-2-3-5-12(10)13/h2-5,11H,6-9H2,1H3 |
| InChIKey | SJIOTCGDYRZJJD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |