C20H29ClN2O2S — CID 46967572
3-[(2-chlorophenyl)methylsulfonyl]-9-piperidin-1-yl-3-azabicyclo[3.3.1]nonane (PubChem CID 46967572) has the molecular formula C20H29ClN2O2S and a molecular weight of 396.98 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylsulfonyl]-9-piperidin-1-yl-3-azabicyclo[3.3.1]nonane.
| Compound Name | 3-[(2-chlorophenyl)methylsulfonyl]-9-piperidin-1-yl-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 46967572 |
| Molecular Formula | C20H29ClN2O2S |
| Molecular Weight | 396.98 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-[(2-chlorophenyl)methylsulfonyl]-9-piperidin-1-yl-3-azabicyclo[3.3.1]nonane |
| SMILES | O=S(=O)(Cc1ccccc1Cl)N1CC2CCCC(C1)C2N1CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O2S/c21-19-10-3-2-7-18(19)15-26(24,25)23-13-16-8-6-9-17(14-23)20(16)22-11-4-1-5-12-22/h2-3,7,10,16-17,20H,1,4-6,8-9,11-15H2 |
| InChIKey | XLUMFTPZQXWGSY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.98 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |