C16H23ClN2O2S — CID 131702233
1-[(2-chlorophenyl)methylsulfonyl]-4-cyclobutyl-1,4-diazepane (PubChem CID 131702233) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-4-cyclobutyl-1,4-diazepane.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-4-cyclobutyl-1,4-diazepane |
|---|---|
| PubChem CID | 131702233 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-4-cyclobutyl-1,4-diazepane |
| SMILES | O=S(=O)(Cc1ccccc1Cl)N1CCCN(C2CCC2)CC1 |
| InChI | InChI=1S/C16H23ClN2O2S/c17-16-8-2-1-5-14(16)13-22(20,21)19-10-4-9-18(11-12-19)15-6-3-7-15/h1-2,5,8,15H,3-4,6-7,9-13H2 |
| InChIKey | MXODNFQTJVWSDI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |