C16H25Cl2N3O2S — CID 163331891
1-(2-chlorophenyl)-N-(4-cyclopentylpiperazin-1-yl)methanesulfonamide;hydrochloride (PubChem CID 163331891) has the molecular formula C16H25Cl2N3O2S and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(4-cyclopentylpiperazin-1-yl)methanesulfonamide;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-N-(4-cyclopentylpiperazin-1-yl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 163331891 |
| Molecular Formula | C16H25Cl2N3O2S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(4-cyclopentylpiperazin-1-yl)methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1Cl)NN1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2S.ClH/c17-16-8-4-1-5-14(16)13-23(21,22)18-20-11-9-19(10-12-20)15-6-2-3-7-15;/h1,4-5,8,15,18H,2-3,6-7,9-13H2;1H |
| InChIKey | RELQDCFMAQDDRM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |