C17H23ClN2O — CID 42168054
4-[(2-chlorophenyl)methyl]-1-cyclopentyl-1,4-diazepan-5-one (PubChem CID 42168054) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-1-cyclopentyl-1,4-diazepan-5-one.
| Compound Name | 4-[(2-chlorophenyl)methyl]-1-cyclopentyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42168054 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-1-cyclopentyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C2CCCC2)CCN1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN2O/c18-16-8-4-1-5-14(16)13-20-12-11-19(10-9-17(20)21)15-6-2-3-7-15/h1,4-5,8,15H,2-3,6-7,9-13H2 |
| InChIKey | ABXCIDSWWSRRMG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |