C16H24ClNO3S — CID 86972438
1-(2-chlorophenyl)-N-(2-cycloheptyloxyethyl)methanesulfonamide (PubChem CID 86972438) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-cycloheptyloxyethyl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2-cycloheptyloxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 86972438 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-cycloheptyloxyethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1Cl)NCCOC1CCCCCC1 |
| InChI | InChI=1S/C16H24ClNO3S/c17-16-10-6-5-7-14(16)13-22(19,20)18-11-12-21-15-8-3-1-2-4-9-15/h5-7,10,15,18H,1-4,8-9,11-13H2 |
| InChIKey | WKMRBXKCBXNXIL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|