C15H23ClN2O3S — CID 126807255
3-[1-[(2-chlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine (PubChem CID 126807255) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is 3-[1-[(2-chlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-[(2-chlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 126807255 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[1-[(2-chlorophenyl)methylsulfonyl]piperidin-4-yl]oxypropan-1-amine |
| SMILES | NCCCOC1CCN(S(=O)(=O)Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H23ClN2O3S/c16-15-5-2-1-4-13(15)12-22(19,20)18-9-6-14(7-10-18)21-11-3-8-17/h1-2,4-5,14H,3,6-12,17H2 |
| InChIKey | PQCRVNLTYKVTIW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|