C14H19F3N2O3S — CID 119992630
3-[1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine (PubChem CID 119992630) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is 3-[1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 119992630 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-[1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
| SMILES | NCCCOC1CCN(S(=O)(=O)c2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H19F3N2O3S/c15-10-8-12(16)14(13(17)9-10)23(20,21)19-5-2-11(3-6-19)22-7-1-4-18/h8-9,11H,1-7,18H2 |
| InChIKey | GLWPZVCCXRJAFF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|