C16H25FN2O3S — CID 120712446
3-[1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine (PubChem CID 120712446) has the molecular formula C16H25FN2O3S and a molecular weight of 344.45 g/mol. Its IUPAC name is 3-[1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 120712446 |
| Molecular Formula | C16H25FN2O3S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[1-(4-fluoro-2,6-dimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCC(OCCCN)CC1 |
| InChI | InChI=1S/C16H25FN2O3S/c1-12-10-14(17)11-13(2)16(12)23(20,21)19-7-4-15(5-8-19)22-9-3-6-18/h10-11,15H,3-9,18H2,1-2H3 |
| InChIKey | UTALFOLBHSJFSR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|