C14H21Cl2FN2O3S — CID 119992755
3-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992755) has the molecular formula C14H21Cl2FN2O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992755 |
| Molecular Formula | C14H21Cl2FN2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-[1-(2-chloro-4-fluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClFN2O3S.ClH/c15-13-10-11(16)2-3-14(13)22(19,20)18-7-4-12(5-8-18)21-9-1-6-17;/h2-3,10,12H,1,4-9,17H2;1H |
| InChIKey | DETWMPQDMIUMHN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|