C16H24Cl2N2O5S — CID 119992772
3-[1-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992772) has the molecular formula C16H24Cl2N2O5S and a molecular weight of 427.35 g/mol. Its IUPAC name is 3-[1-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992772 |
| Molecular Formula | C16H24Cl2N2O5S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 3-[1-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfonyl]piperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2cc3c(cc2Cl)OCCO3)CC1 |
| InChI | InChI=1S/C16H23ClN2O5S.ClH/c17-13-10-14-15(24-9-8-23-14)11-16(13)25(20,21)19-5-2-12(3-6-19)22-7-1-4-18;/h10-12H,1-9,18H2;1H |
| InChIKey | AMJSENSFVWDISF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|