C14H20ClF3N2O3S — CID 119992838
3-[1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992838) has the molecular formula C14H20ClF3N2O3S and a molecular weight of 388.84 g/mol. Its IUPAC name is 3-[1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992838 |
| Molecular Formula | C14H20ClF3N2O3S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-[1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H19F3N2O3S.ClH/c15-12-8-11(9-13(16)14(12)17)23(20,21)19-5-2-10(3-6-19)22-7-1-4-18;/h8-10H,1-7,18H2;1H |
| InChIKey | IYWIFTXSMSZHMK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|