C17H29ClN2O3S — CID 119992733
3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992733) has the molecular formula C17H29ClN2O3S and a molecular weight of 376.95 g/mol. Its IUPAC name is 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992733 |
| Molecular Formula | C17H29ClN2O3S |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(OCCCN)CC2)c(C)c1.Cl |
| InChI | InChI=1S/C17H28N2O3S.ClH/c1-13-11-14(2)17(15(3)12-13)23(20,21)19-8-5-16(6-9-19)22-10-4-7-18;/h11-12,16H,4-10,18H2,1-3H3;1H |
| InChIKey | JSTDZNKBIJXFCL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|