C14H22Cl2N2O3S — CID 119992794
3-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992794) has the molecular formula C14H22Cl2N2O3S and a molecular weight of 369.31 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992794 |
| Molecular Formula | C14H22Cl2N2O3S |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H21ClN2O3S.ClH/c15-13-4-1-2-5-14(13)21(18,19)17-9-6-12(7-10-17)20-11-3-8-16;/h1-2,4-5,12H,3,6-11,16H2;1H |
| InChIKey | ZEYZSZLLGSSAPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|