C16H24Cl2N2O5S — CID 119992696
methyl 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-3-chlorobenzoate;hydrochloride (PubChem CID 119992696) has the molecular formula C16H24Cl2N2O5S and a molecular weight of 427.35 g/mol. Its IUPAC name is methyl 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-3-chlorobenzoate;hydrochloride.
| Compound Name | methyl 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-3-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119992696 |
| Molecular Formula | C16H24Cl2N2O5S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | methyl 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-3-chlorobenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(OCCCN)CC2)c(Cl)c1.Cl |
| InChI | InChI=1S/C16H23ClN2O5S.ClH/c1-23-16(20)12-3-4-15(14(17)11-12)25(21,22)19-8-5-13(6-9-19)24-10-2-7-18;/h3-4,11,13H,2,5-10,18H2,1H3;1H |
| InChIKey | IXGCGXOTNRRLLV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|