C11H15ClN2O4S — CID 119962169
methyl 4-(3-aminopropylsulfamoyl)-3-chlorobenzoate (PubChem CID 119962169) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is methyl 4-(3-aminopropylsulfamoyl)-3-chlorobenzoate.
| Compound Name | methyl 4-(3-aminopropylsulfamoyl)-3-chlorobenzoate |
|---|---|
| PubChem CID | 119962169 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | methyl 4-(3-aminopropylsulfamoyl)-3-chlorobenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCCN)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O4S/c1-18-11(15)8-3-4-10(9(12)7-8)19(16,17)14-6-2-5-13/h3-4,7,14H,2,5-6,13H2,1H3 |
| InChIKey | ABSNNXBRDHSCAR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|