C13H19ClN2O4S — CID 120716497
methyl 3-chloro-4-[2-(propylamino)ethylsulfamoyl]benzoate (PubChem CID 120716497) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is methyl 3-chloro-4-[2-(propylamino)ethylsulfamoyl]benzoate.
| Compound Name | methyl 3-chloro-4-[2-(propylamino)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 120716497 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 3-chloro-4-[2-(propylamino)ethylsulfamoyl]benzoate |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(C(=O)OC)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O4S/c1-3-6-15-7-8-16-21(18,19)12-5-4-10(9-11(12)14)13(17)20-2/h4-5,9,15-16H,3,6-8H2,1-2H3 |
| InChIKey | OBMKAKCVRZANBD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|