methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate

C12H18N2O4S — CID 119962127

IUPACmethyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate
SMILESCOC(=O)c1cccc(S(=O)(=O)NCCCN)c1C
InChIInChI=1S/C12H18N2O4S/c1-9-10(12(15)18-2)5-3-6-11(9)19(16,17)14-8-4-7-13/h3,5-6,14H,4,7-8,13H2,1-2H3
InChIKeyYDJPXEYNPAPFPY-UHFFFAOYSA-N
MW286.35 g/mol
LogP0.41
Rot. Bonds6

About methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate

methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate (PubChem CID 119962127) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate.

Molecular Properties

Compound Namemethyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate
PubChem CID119962127
Molecular FormulaC12H18N2O4S
Molecular Weight286.35 g/mol
Exact Mass286.10
IUPAC Namemethyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate
SMILESCOC(=O)c1cccc(S(=O)(=O)NCCCN)c1C
InChIInChI=1S/C12H18N2O4S/c1-9-10(12(15)18-2)5-3-6-11(9)19(16,17)14-8-4-7-13/h3,5-6,14H,4,7-8,13H2,1-2H3
InChIKeyYDJPXEYNPAPFPY-UHFFFAOYSA-N
XLogP0.41
TPSA98.49 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.35
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate?
The IUPAC name of methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate (CID 119962127) is methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate.
What is the SMILES notation for methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate?
The canonical SMILES for methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate is COC(=O)c1cccc(S(=O)(=O)NCCCN)c1C.
What is the InChIKey of methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate?
The InChIKey is YDJPXEYNPAPFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-9-10(12(15)18-2)5-3-6-11(9)19(16,17)14-8-4-7-13/h3,5-6,14H,4,7-8,13H2,1-2H3.
What are the key properties of methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate?
methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate has a molecular weight of 286.35 g/mol, XLogP of 0.41, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-aminopropylsulfamoyl)-2-methylbenzoate is sourced from PubChem (CID 119962127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).