C13H20N2O4S — CID 120706731
ethyl 3-(3-aminopropylsulfamoyl)-4-methylbenzoate (PubChem CID 120706731) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl 3-(3-aminopropylsulfamoyl)-4-methylbenzoate.
| Compound Name | ethyl 3-(3-aminopropylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 120706731 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 3-(3-aminopropylsulfamoyl)-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)NCCCN)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-3-19-13(16)11-6-5-10(2)12(9-11)20(17,18)15-8-4-7-14/h5-6,9,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | GUXHDBRYJRAQLI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|