C18H28N2O5S — CID 120896425
ethyl 3-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]-4-methylbenzoate (PubChem CID 120896425) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is ethyl 3-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]-4-methylbenzoate.
| Compound Name | ethyl 3-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 120896425 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethyl 3-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)NCC2(COC)CCNCC2)c1 |
| InChI | InChI=1S/C18H28N2O5S/c1-4-25-17(21)15-6-5-14(2)16(11-15)26(22,23)20-12-18(13-24-3)7-9-19-10-8-18/h5-6,11,19-20H,4,7-10,12-13H2,1-3H3 |
| InChIKey | AOMLFMGFZYPPDM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |