C15H24N2O6S — CID 120896379
ethyl 5-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]furan-2-carboxylate (PubChem CID 120896379) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is ethyl 5-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 120896379 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | ethyl 5-[[4-(methoxymethyl)piperidin-4-yl]methylsulfamoyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCC2(COC)CCNCC2)o1 |
| InChI | InChI=1S/C15H24N2O6S/c1-3-22-14(18)12-4-5-13(23-12)24(19,20)17-10-15(11-21-2)6-8-16-9-7-15/h4-5,16-17H,3,6-11H2,1-2H3 |
| InChIKey | AEVMVLBUOFHGEL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |